About (3S)-3-methyl-3,3a-dihydro-2H-indazole
(3S)-3-methyl-3,3a-dihydro-2H-indazole (PubChem CID 89185392) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is (3S)-3-methyl-3,3a-dihydro-2H-indazole.
Molecular Properties
| Compound Name | (3S)-3-methyl-3,3a-dihydro-2H-indazole |
| PubChem CID | 89185392 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (3S)-3-methyl-3,3a-dihydro-2H-indazole |
| SMILES | C[C@@H]1NN=C2C=CC=CC21 |
| InChI | InChI=1S/C8H10N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-7,9H,1H3/t6-,7?/m0/s1 |
| InChIKey | ROENNQSFZMTJDS-PKPIPKONSA-N |
| XLogP | 1.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-methyl-3,3a-dihydro-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methyl-3,3a-dihydro-2H-indazole?
The IUPAC name of (3S)-3-methyl-3,3a-dihydro-2H-indazole (CID 89185392) is (3S)-3-methyl-3,3a-dihydro-2H-indazole.
What is the SMILES notation for (3S)-3-methyl-3,3a-dihydro-2H-indazole?
The canonical SMILES for (3S)-3-methyl-3,3a-dihydro-2H-indazole is C[C@@H]1NN=C2C=CC=CC21.
What is the InChIKey of (3S)-3-methyl-3,3a-dihydro-2H-indazole?
The InChIKey is ROENNQSFZMTJDS-PKPIPKONSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-7-4-2-3-5-8(7)10-9-6/h2-7,9H,1H3/t6-,7?/m0/s1.
What are the key properties of (3S)-3-methyl-3,3a-dihydro-2H-indazole?
(3S)-3-methyl-3,3a-dihydro-2H-indazole has a molecular weight of 134.18 g/mol, XLogP of 1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methyl-3,3a-dihydro-2H-indazole is sourced from PubChem (CID 89185392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).