C18H26FN3O4S2 — CID 89185403
[(1R,2R,5R)-5-methyl-2-propan-2-yl-2-sulfanylcyclohexyl] (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate (PubChem CID 89185403) has the molecular formula C18H26FN3O4S2 and a molecular weight of 431.56 g/mol. Its IUPAC name is [(1R,2R,5R)-5-methyl-2-propan-2-yl-2-sulfanylcyclohexyl] (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate.
| Compound Name | [(1R,2R,5R)-5-methyl-2-propan-2-yl-2-sulfanylcyclohexyl] (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate |
|---|---|
| PubChem CID | 89185403 |
| Molecular Formula | C18H26FN3O4S2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [(1R,2R,5R)-5-methyl-2-propan-2-yl-2-sulfanylcyclohexyl] (2R,5S)-5-(4-amino-5-fluoro-2-oxopyrimidin-1-yl)-1,3-oxathiolane-2-carboxylate |
| SMILES | CC(C)[C@]1(S)CC[C@@H](C)C[C@H]1OC(=O)[C@@H]1O[C@H](n2cc(F)c(N)nc2=O)CS1 |
| InChI | InChI=1S/C18H26FN3O4S2/c1-9(2)18(27)5-4-10(3)6-12(18)25-15(23)16-26-13(8-28-16)22-7-11(19)14(20)21-17(22)24/h7,9-10,12-13,16,27H,4-6,8H2,1-3H3,(H2,20,21,24)/t10-,12-,13+,16-,18-/m1/s1 |
| InChIKey | AJXUDTDZQCMOMW-YBDPJIJVSA-N |
| XLogP | 2.61 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|