C29H54O4 — CID 89185556
2,2-dimethyl-7-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-4-oxooctan-2-yl]oxydodec-11-en-3-one (PubChem CID 89185556) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is 2,2-dimethyl-7-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-4-oxooctan-2-yl]oxydodec-11-en-3-one.
| Compound Name | 2,2-dimethyl-7-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-4-oxooctan-2-yl]oxydodec-11-en-3-one |
|---|---|
| PubChem CID | 89185556 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | 2,2-dimethyl-7-[2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]-4-oxooctan-2-yl]oxydodec-11-en-3-one |
| SMILES | C=CCCCC(CCCC(=O)C(C)(C)C)OC(C)(C)C(C)(C)C(=O)CCCCOC(C)(C)C |
| InChI | InChI=1S/C29H54O4/c1-12-13-14-18-23(19-17-21-24(30)26(2,3)4)33-29(10,11)28(8,9)25(31)20-15-16-22-32-27(5,6)7/h12,23H,1,13-22H2,2-11H3 |
| InChIKey | PPWOZTVYMCRZSZ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|