C31H51NO8S — CID 89185610
2-[[9,9-dimethyl-8-oxo-7-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonic acid (PubChem CID 89185610) has the molecular formula C31H51NO8S and a molecular weight of 597.82 g/mol. Its IUPAC name is 2-[[9,9-dimethyl-8-oxo-7-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonic acid.
| Compound Name | 2-[[9,9-dimethyl-8-oxo-7-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 89185610 |
| Molecular Formula | C31H51NO8S |
| Molecular Weight | 597.82 g/mol |
| Exact Mass | 597.33 |
| IUPAC Name | 2-[[9,9-dimethyl-8-oxo-7-[2,3,3-trimethyl-5-[(2-methylpropan-2-yl)oxy]-4-oxohexan-2-yl]oxydecanoyl]amino]benzenesulfonic acid |
| SMILES | CC(OC(C)(C)C)C(=O)C(C)(C)C(C)(C)OC(CCCCCC(=O)Nc1ccccc1S(=O)(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C31H51NO8S/c1-21(39-29(5,6)7)26(34)30(8,9)31(10,11)40-23(27(35)28(2,3)4)18-13-12-14-20-25(33)32-22-17-15-16-19-24(22)41(36,37)38/h15-17,19,21,23H,12-14,18,20H2,1-11H3,(H,32,33)(H,36,37,38) |
| InChIKey | JQEYDJVMPXBJCY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.82 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|