About 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile
3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile (PubChem CID 89185681) has the molecular formula C14H30N4O4
and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile.
Molecular Properties
| Compound Name | 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile |
| PubChem CID | 89185681 |
| Molecular Formula | C14H30N4O4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile |
| SMILES | N#CCCOCC(COCCN)(COCCN)COCCN |
| InChI | InChI=1S/C14H30N4O4/c15-2-1-6-19-10-14(11-20-7-3-16,12-21-8-4-17)13-22-9-5-18/h1,3-13,16-18H2 |
| InChIKey | UEZFQABPYOTEQM-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile?
The IUPAC name of 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile (CID 89185681) is 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile.
What is the SMILES notation for 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile?
The canonical SMILES for 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile is N#CCCOCC(COCCN)(COCCN)COCCN.
What is the InChIKey of 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile?
The InChIKey is UEZFQABPYOTEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N4O4/c15-2-1-6-19-10-14(11-20-7-3-16,12-21-8-4-17)13-22-9-5-18/h1,3-13,16-18H2.
What are the key properties of 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile?
3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile has a molecular weight of 318.42 g/mol, XLogP of -1.17, 16 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-aminoethoxy)-2,2-bis(2-aminoethoxymethyl)propoxy]propanenitrile is sourced from PubChem (CID 89185681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).