About (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine
(E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine (PubChem CID 89185795) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine |
| PubChem CID | 89185795 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine |
| SMILES | C=C/C(=C\CNCN)CN |
| InChI | InChI=1S/C7H15N3/c1-2-7(5-8)3-4-10-6-9/h2-3,10H,1,4-6,8-9H2/b7-3+ |
| InChIKey | RNLQKMJGLZSSSH-XVNBXDOJSA-N |
| XLogP | -0.44 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine?
The IUPAC name of (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine (CID 89185795) is (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine.
What is the SMILES notation for (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine?
The canonical SMILES for (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine is C=C/C(=C\CNCN)CN.
What is the InChIKey of (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine?
The InChIKey is RNLQKMJGLZSSSH-XVNBXDOJSA-N. The full InChI is InChI=1S/C7H15N3/c1-2-7(5-8)3-4-10-6-9/h2-3,10H,1,4-6,8-9H2/b7-3+.
What are the key properties of (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine?
(E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine has a molecular weight of 141.22 g/mol, XLogP of -0.44, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N'-(aminomethyl)-2-ethenylbut-2-ene-1,4-diamine is sourced from PubChem (CID 89185795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).