About [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine
[(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine (PubChem CID 89185806) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine |
| PubChem CID | 89185806 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine |
| SMILES | NCC1=NC2C=CC=C[C@H]2N1 |
| InChI | InChI=1S/C8H11N3/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4,6-7H,5,9H2,(H,10,11)/t6-,7?/m1/s1 |
| InChIKey | WXCINUXYPWISEY-ULUSZKPHSA-N |
| XLogP | -0.19 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine?
The IUPAC name of [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine (CID 89185806) is [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine.
What is the SMILES notation for [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine?
The canonical SMILES for [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine is NCC1=NC2C=CC=C[C@H]2N1.
What is the InChIKey of [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine?
The InChIKey is WXCINUXYPWISEY-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H11N3/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4,6-7H,5,9H2,(H,10,11)/t6-,7?/m1/s1.
What are the key properties of [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine?
[(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine has a molecular weight of 149.20 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(7aR)-3a,7a-dihydro-1H-benzimidazol-2-yl]methanamine is sourced from PubChem (CID 89185806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).