C26H35N5O — CID 89185835
4-cyclopropyl-2-[2-(pyridin-4-ylmethylamino)prop-2-enyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one (PubChem CID 89185835) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(pyridin-4-ylmethylamino)prop-2-enyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one.
| Compound Name | 4-cyclopropyl-2-[2-(pyridin-4-ylmethylamino)prop-2-enyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 89185835 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 4-cyclopropyl-2-[2-(pyridin-4-ylmethylamino)prop-2-enyl]-5-[[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]amino]pyridazin-3-one |
| SMILES | C=C(Cn1ncc(N[C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)c(C2CC2)c1=O)NCc1ccncc1 |
| InChI | InChI=1S/C26H35N5O/c1-16(28-13-18-7-9-27-10-8-18)15-31-25(32)24(19-5-6-19)23(14-29-31)30-22-12-20-11-21(17(22)2)26(20,3)4/h7-10,14,17,19-22,28,30H,1,5-6,11-13,15H2,2-4H3/t17-,20+,21-,22-/m1/s1 |
| InChIKey | FUYGWKBYHKYUCP-XYEHWOGUSA-N |
| XLogP | 4.30 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |