About (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone
(4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone (PubChem CID 89185858) has the molecular formula C19H27N5O
and a molecular weight of 341.46 g/mol. Its IUPAC name is (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone |
| PubChem CID | 89185858 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone |
| SMILES | Cc1c(CN(C)C2CCN(C(=O)c3ccc(N)cc3)CC2)cnn1C |
| InChI | InChI=1S/C19H27N5O/c1-14-16(12-21-23(14)3)13-22(2)18-8-10-24(11-9-18)19(25)15-4-6-17(20)7-5-15/h4-7,12,18H,8-11,13,20H2,1-3H3 |
| InChIKey | XOLVNLBKDINUDI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone?
The IUPAC name of (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone (CID 89185858) is (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone.
What is the SMILES notation for (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone?
The canonical SMILES for (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone is Cc1c(CN(C)C2CCN(C(=O)c3ccc(N)cc3)CC2)cnn1C.
What is the InChIKey of (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone?
The InChIKey is XOLVNLBKDINUDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N5O/c1-14-16(12-21-23(14)3)13-22(2)18-8-10-24(11-9-18)19(25)15-4-6-17(20)7-5-15/h4-7,12,18H,8-11,13,20H2,1-3H3.
What are the key properties of (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone?
(4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone has a molecular weight of 341.46 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)-[4-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]piperidin-1-yl]methanone is sourced from PubChem (CID 89185858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).