About 1-(3,4,5-trimethylphenyl)ethyldiazene
1-(3,4,5-trimethylphenyl)ethyldiazene (PubChem CID 89185904) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(3,4,5-trimethylphenyl)ethyldiazene.
Molecular Properties
| Compound Name | 1-(3,4,5-trimethylphenyl)ethyldiazene |
| PubChem CID | 89185904 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-(3,4,5-trimethylphenyl)ethyldiazene |
| SMILES | [H]/N=N/C(C)c1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C11H16N2/c1-7-5-11(10(4)13-12)6-8(2)9(7)3/h5-6,10,12H,1-4H3/b13-12+ |
| InChIKey | BAXPDPZPPZGKLR-OUKQBFOZSA-N |
| XLogP | 3.70 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4,5-trimethylphenyl)ethyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4,5-trimethylphenyl)ethyldiazene?
The IUPAC name of 1-(3,4,5-trimethylphenyl)ethyldiazene (CID 89185904) is 1-(3,4,5-trimethylphenyl)ethyldiazene.
What is the SMILES notation for 1-(3,4,5-trimethylphenyl)ethyldiazene?
The canonical SMILES for 1-(3,4,5-trimethylphenyl)ethyldiazene is [H]/N=N/C(C)c1cc(C)c(C)c(C)c1.
What is the InChIKey of 1-(3,4,5-trimethylphenyl)ethyldiazene?
The InChIKey is BAXPDPZPPZGKLR-OUKQBFOZSA-N. The full InChI is InChI=1S/C11H16N2/c1-7-5-11(10(4)13-12)6-8(2)9(7)3/h5-6,10,12H,1-4H3/b13-12+.
What are the key properties of 1-(3,4,5-trimethylphenyl)ethyldiazene?
1-(3,4,5-trimethylphenyl)ethyldiazene has a molecular weight of 176.26 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4,5-trimethylphenyl)ethyldiazene is sourced from PubChem (CID 89185904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).