About 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene
3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 89185915) has the molecular formula C8H9FS
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| PubChem CID | 89185915 |
| Molecular Formula | C8H9FS |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | CC1CCc2c(F)csc21 |
| InChI | InChI=1S/C8H9FS/c1-5-2-3-6-7(9)4-10-8(5)6/h4-5H,2-3H2,1H3 |
| InChIKey | FTYYNGLLMSCKRR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The IUPAC name of 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene (CID 89185915) is 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
What is the SMILES notation for 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The canonical SMILES for 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene is CC1CCc2c(F)csc21.
What is the InChIKey of 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
The InChIKey is FTYYNGLLMSCKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FS/c1-5-2-3-6-7(9)4-10-8(5)6/h4-5H,2-3H2,1H3.
What are the key properties of 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene?
3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene has a molecular weight of 156.22 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-5,6-dihydro-4H-cyclopenta[b]thiophene is sourced from PubChem (CID 89185915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).