About cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile
cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile (PubChem CID 89186279) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile.
Molecular Properties
| Compound Name | cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile |
| PubChem CID | 89186279 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile |
| SMILES | CC(C)=C[C@@H]1[C@H](C#N)C1(C)C |
| InChI | InChI=1S/C10H15N/c1-7(2)5-8-9(6-11)10(8,3)4/h5,8-9H,1-4H3/t8-,9+/m1/s1 |
| InChIKey | WDSAIUNCHKDXDU-BDAKNGLRSA-N |
| XLogP | 2.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile?
The IUPAC name of cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile (CID 89186279) is cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile.
What is the SMILES notation for cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile?
The canonical SMILES for cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile is CC(C)=C[C@@H]1[C@H](C#N)C1(C)C.
What is the InChIKey of cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile?
The InChIKey is WDSAIUNCHKDXDU-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H15N/c1-7(2)5-8-9(6-11)10(8,3)4/h5,8-9H,1-4H3/t8-,9+/m1/s1.
What are the key properties of cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile?
cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile has a molecular weight of 149.24 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonitrile is sourced from PubChem (CID 89186279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).