C24H27F3N3O2- — CID 89186555
1-[(1R,9R,13S)-4-(benzylamino)-1,13-dimethyl-5-[methyl(oxido)amino]-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone (PubChem CID 89186555) has the molecular formula C24H27F3N3O2- and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-[(1R,9R,13S)-4-(benzylamino)-1,13-dimethyl-5-[methyl(oxido)amino]-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1R,9R,13S)-4-(benzylamino)-1,13-dimethyl-5-[methyl(oxido)amino]-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 89186555 |
| Molecular Formula | C24H27F3N3O2- |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-[(1R,9R,13S)-4-(benzylamino)-1,13-dimethyl-5-[methyl(oxido)amino]-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-10-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@@H]1[C@H]2Cc3cc(N(C)[O-])c(NCc4ccccc4)cc3[C@]1(C)CCN2C(=O)C(F)(F)F |
| InChI | InChI=1S/C24H27F3N3O2/c1-15-20-11-17-12-21(29(3)32)19(28-14-16-7-5-4-6-8-16)13-18(17)23(15,2)9-10-30(20)22(31)24(25,26)27/h4-8,12-13,15,20,28H,9-11,14H2,1-3H3/q-1/t15-,20-,23-/m1/s1 |
| InChIKey | WQCLVMVCSAPAPU-ZFUCPZCZSA-N |
| XLogP | 4.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|