About 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine
2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine (PubChem CID 89186747) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine |
| PubChem CID | 89186747 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine |
| SMILES | CC1Cc2ccnc(N)c2S1 |
| InChI | InChI=1S/C8H10N2S/c1-5-4-6-2-3-10-8(9)7(6)11-5/h2-3,5H,4H2,1H3,(H2,9,10) |
| InChIKey | SXXCFETVYOJTDR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine?
The IUPAC name of 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine (CID 89186747) is 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine.
What is the SMILES notation for 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine?
The canonical SMILES for 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine is CC1Cc2ccnc(N)c2S1.
What is the InChIKey of 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine?
The InChIKey is SXXCFETVYOJTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S/c1-5-4-6-2-3-10-8(9)7(6)11-5/h2-3,5H,4H2,1H3,(H2,9,10).
What are the key properties of 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine?
2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine has a molecular weight of 166.25 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydrothieno[2,3-c]pyridin-7-amine is sourced from PubChem (CID 89186747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).