C9H12N2O2 — CID 89186759
(2E)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-hydroxyiminoacetamide (PubChem CID 89186759) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2E)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-hydroxyiminoacetamide.
| Compound Name | (2E)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 89186759 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2E)-N-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-2-hydroxyiminoacetamide |
| SMILES | C=C(/C=C\C=C/C)NC(=O)/C=N/O |
| InChI | InChI=1S/C9H12N2O2/c1-3-4-5-6-8(2)11-9(12)7-10-13/h3-7,13H,2H2,1H3,(H,11,12)/b4-3-,6-5-,10-7+ |
| InChIKey | KTHPIRWJSLZRBL-PZOXCDAASA-N |
| XLogP | 1.21 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|