C31H54O4Si — CID 89186815
[(1S,3R,7S,8S,8aR)-8-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 89186815) has the molecular formula C31H54O4Si and a molecular weight of 518.86 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 89186815 |
| Molecular Formula | C31H54O4Si |
| Molecular Weight | 518.86 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[(5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CC[C@H](CC(=O)CC[C@@H]1[C@@H]2C(=C[C@H](C)C[C@@H]2OC(=O)C(C)(C)CC)C=C[C@@H]1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O4Si/c1-12-25(35-36(10,11)30(5,6)7)20-24(32)16-17-26-22(4)14-15-23-18-21(3)19-27(28(23)26)34-29(33)31(8,9)13-2/h14-15,18,21-22,25-28H,12-13,16-17,19-20H2,1-11H3/t21-,22-,25+,26-,27-,28-/m0/s1 |
| InChIKey | OQMNXQWNWQIXOD-KTEPXGGLSA-N |
| XLogP | 8.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.86 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|