C27H41FN3O9PS — CID 89186837
2-diethoxyphosphoryl-N-[4-(4-fluorophenyl)-6-propan-2-yl-5-[(E,3S,5R)-3,5,7,7-tetrahydroxyhept-1-enyl]pyrimidin-2-yl]-N-methylethanesulfonamide (PubChem CID 89186837) has the molecular formula C27H41FN3O9PS and a molecular weight of 633.68 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-N-[4-(4-fluorophenyl)-6-propan-2-yl-5-[(E,3S,5R)-3,5,7,7-tetrahydroxyhept-1-enyl]pyrimidin-2-yl]-N-methylethanesulfonamide.
| Compound Name | 2-diethoxyphosphoryl-N-[4-(4-fluorophenyl)-6-propan-2-yl-5-[(E,3S,5R)-3,5,7,7-tetrahydroxyhept-1-enyl]pyrimidin-2-yl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 89186837 |
| Molecular Formula | C27H41FN3O9PS |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 2-diethoxyphosphoryl-N-[4-(4-fluorophenyl)-6-propan-2-yl-5-[(E,3S,5R)-3,5,7,7-tetrahydroxyhept-1-enyl]pyrimidin-2-yl]-N-methylethanesulfonamide |
| SMILES | CCOP(=O)(CCS(=O)(=O)N(C)c1nc(-c2ccc(F)cc2)c(/C=C/[C@@H](O)C[C@@H](O)CC(O)O)c(C(C)C)n1)OCC |
| InChI | InChI=1S/C27H41FN3O9PS/c1-6-39-41(36,40-7-2)14-15-42(37,38)31(5)27-29-25(18(3)4)23(13-12-21(32)16-22(33)17-24(34)35)26(30-27)19-8-10-20(28)11-9-19/h8-13,18,21-22,24,32-35H,6-7,14-17H2,1-5H3/b13-12+/t21-,22-/m1/s1 |
| InChIKey | BPRRUGTYJXGPOU-ITWZMISCSA-N |
| XLogP | 3.26 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|