About 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole
4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole (PubChem CID 89186950) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole |
| PubChem CID | 89186950 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole |
| SMILES | CCCc1nc(-c2cocn2)co1 |
| InChI | InChI=1S/C9H10N2O2/c1-2-3-9-11-8(5-13-9)7-4-12-6-10-7/h4-6H,2-3H2,1H3 |
| InChIKey | PFRHPNSWSFHSAX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole?
The IUPAC name of 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole (CID 89186950) is 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole.
What is the SMILES notation for 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole?
The canonical SMILES for 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole is CCCc1nc(-c2cocn2)co1.
What is the InChIKey of 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole?
The InChIKey is PFRHPNSWSFHSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-2-3-9-11-8(5-13-9)7-4-12-6-10-7/h4-6H,2-3H2,1H3.
What are the key properties of 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole?
4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole has a molecular weight of 178.19 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-oxazol-4-yl)-2-propyl-1,3-oxazole is sourced from PubChem (CID 89186950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).