About N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine
N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine (PubChem CID 89186964) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine |
| PubChem CID | 89186964 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine |
| SMILES | C/C=C\C=C(/N=C/C)C(CC)CCC |
| InChI | InChI=1S/C13H23N/c1-5-9-11-13(14-8-4)12(7-3)10-6-2/h5,8-9,11-12H,6-7,10H2,1-4H3/b9-5-,13-11-,14-8+ |
| InChIKey | OWTIDIWMINGWDO-PVXZYECESA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine?
The IUPAC name of N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine (CID 89186964) is N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine.
What is the SMILES notation for N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine?
The canonical SMILES for N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine is C/C=C\C=C(/N=C/C)C(CC)CCC.
What is the InChIKey of N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine?
The InChIKey is OWTIDIWMINGWDO-PVXZYECESA-N. The full InChI is InChI=1S/C13H23N/c1-5-9-11-13(14-8-4)12(7-3)10-6-2/h5,8-9,11-12H,6-7,10H2,1-4H3/b9-5-,13-11-,14-8+.
What are the key properties of N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine?
N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine has a molecular weight of 193.33 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,4Z)-6-ethylnona-2,4-dien-5-yl]ethanimine is sourced from PubChem (CID 89186964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).