About 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole
2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole (PubChem CID 89187216) has the molecular formula C16H12Cl2F3NO
and a molecular weight of 362.18 g/mol. Its IUPAC name is 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole |
| PubChem CID | 89187216 |
| Molecular Formula | C16H12Cl2F3NO |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole |
| SMILES | FC(F)(F)Oc1cccc(CC2c3ccc(Cl)cc3NC2Cl)c1 |
| InChI | InChI=1S/C16H12Cl2F3NO/c17-10-4-5-12-13(15(18)22-14(12)8-10)7-9-2-1-3-11(6-9)23-16(19,20)21/h1-6,8,13,15,22H,7H2 |
| InChIKey | RUPOUKXSIKCTIY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole?
The IUPAC name of 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole (CID 89187216) is 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole.
What is the SMILES notation for 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole?
The canonical SMILES for 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole is FC(F)(F)Oc1cccc(CC2c3ccc(Cl)cc3NC2Cl)c1.
What is the InChIKey of 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole?
The InChIKey is RUPOUKXSIKCTIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2F3NO/c17-10-4-5-12-13(15(18)22-14(12)8-10)7-9-2-1-3-11(6-9)23-16(19,20)21/h1-6,8,13,15,22H,7H2.
What are the key properties of 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole?
2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole has a molecular weight of 362.18 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-3-[[3-(trifluoromethoxy)phenyl]methyl]-2,3-dihydro-1H-indole is sourced from PubChem (CID 89187216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).