C15H22O5S2 — CID 89187367
methyl 2-[(5S)-6-(1,3-dithian-2-yl)-4-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl]acetate (PubChem CID 89187367) has the molecular formula C15H22O5S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 2-[(5S)-6-(1,3-dithian-2-yl)-4-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl]acetate.
| Compound Name | methyl 2-[(5S)-6-(1,3-dithian-2-yl)-4-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl]acetate |
|---|---|
| PubChem CID | 89187367 |
| Molecular Formula | C15H22O5S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | methyl 2-[(5S)-6-(1,3-dithian-2-yl)-4-hydroxy-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-2-benzofuran-5-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(O)C2C(=O)OCC2CC1C1SCCCS1 |
| InChI | InChI=1S/C15H22O5S2/c1-19-11(16)6-9-10(15-21-3-2-4-22-15)5-8-7-20-14(18)12(8)13(9)17/h8-10,12-13,15,17H,2-7H2,1H3/t8?,9-,10?,12?,13?/m0/s1 |
| InChIKey | VUBUXWVABRCPGZ-LBUIXZGHSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |