C14H27IOSi — CID 89187746
tert-butyl-[(1R,5S)-2-(iodomethyl)-5-methylcyclohex-2-en-1-yl]oxy-dimethylsilane (PubChem CID 89187746) has the molecular formula C14H27IOSi and a molecular weight of 366.36 g/mol. Its IUPAC name is tert-butyl-[(1R,5S)-2-(iodomethyl)-5-methylcyclohex-2-en-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,5S)-2-(iodomethyl)-5-methylcyclohex-2-en-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89187746 |
| Molecular Formula | C14H27IOSi |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | tert-butyl-[(1R,5S)-2-(iodomethyl)-5-methylcyclohex-2-en-1-yl]oxy-dimethylsilane |
| SMILES | C[C@H]1CC=C(CI)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H27IOSi/c1-11-7-8-12(10-15)13(9-11)16-17(5,6)14(2,3)4/h8,11,13H,7,9-10H2,1-6H3/t11-,13+/m0/s1 |
| InChIKey | FOSPZICETYENSY-WCQYABFASA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|