C17H34O3Si — CID 89187754
(4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enal (PubChem CID 89187754) has the molecular formula C17H34O3Si and a molecular weight of 314.54 g/mol. Its IUPAC name is (4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enal.
| Compound Name | (4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enal |
|---|---|
| PubChem CID | 89187754 |
| Molecular Formula | C17H34O3Si |
| Molecular Weight | 314.54 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (4R,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2,4-dimethyloct-7-enal |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CC(C)C=O |
| InChI | InChI=1S/C17H34O3Si/c1-10-15(19-7)16(14(3)11-13(2)12-18)20-21(8,9)17(4,5)6/h10,12-16H,1,11H2,2-9H3/t13?,14-,15+,16+/m1/s1 |
| InChIKey | FATCDZUOBBOSLV-BSLWCIKASA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|