About ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate
ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate (PubChem CID 89187766) has the molecular formula C12H17FO2
and a molecular weight of 212.26 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate |
| PubChem CID | 89187766 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate |
| SMILES | C=C1[C@H](C)C/C(=C/C(=O)OCC)C[C@@H]1F |
| InChI | InChI=1S/C12H17FO2/c1-4-15-12(14)7-10-5-8(2)9(3)11(13)6-10/h7-8,11H,3-6H2,1-2H3/b10-7-/t8-,11+/m1/s1 |
| InChIKey | JTGRHVYFFSDWJB-RWRDUZIXSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate (CID 89187766) is ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate is C=C1[C@H](C)C/C(=C/C(=O)OCC)C[C@@H]1F.
What is the InChIKey of ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate?
The InChIKey is JTGRHVYFFSDWJB-RWRDUZIXSA-N. The full InChI is InChI=1S/C12H17FO2/c1-4-15-12(14)7-10-5-8(2)9(3)11(13)6-10/h7-8,11H,3-6H2,1-2H3/b10-7-/t8-,11+/m1/s1.
What are the key properties of ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate?
ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate has a molecular weight of 212.26 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[(3S,5R)-3-fluoro-5-methyl-4-methylidenecyclohexylidene]acetate is sourced from PubChem (CID 89187766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).