C46H34F4N4 — CID 89187954
7-[4-[2,3-bis(4-fluorophenyl)-7,8-dihydroquinoxalin-6-yl]cyclohexa-1,3-dien-1-yl]-2-(4-fluorocyclohexa-1,5-dien-1-yl)-3-(4-fluorophenyl)-5,6-dihydroquinoxaline (PubChem CID 89187954) has the molecular formula C46H34F4N4 and a molecular weight of 718.80 g/mol. Its IUPAC name is 7-[4-[2,3-bis(4-fluorophenyl)-7,8-dihydroquinoxalin-6-yl]cyclohexa-1,3-dien-1-yl]-2-(4-fluorocyclohexa-1,5-dien-1-yl)-3-(4-fluorophenyl)-5,6-dihydroquinoxaline.
| Compound Name | 7-[4-[2,3-bis(4-fluorophenyl)-7,8-dihydroquinoxalin-6-yl]cyclohexa-1,3-dien-1-yl]-2-(4-fluorocyclohexa-1,5-dien-1-yl)-3-(4-fluorophenyl)-5,6-dihydroquinoxaline |
|---|---|
| PubChem CID | 89187954 |
| Molecular Formula | C46H34F4N4 |
| Molecular Weight | 718.80 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | 7-[4-[2,3-bis(4-fluorophenyl)-7,8-dihydroquinoxalin-6-yl]cyclohexa-1,3-dien-1-yl]-2-(4-fluorocyclohexa-1,5-dien-1-yl)-3-(4-fluorophenyl)-5,6-dihydroquinoxaline |
| SMILES | Fc1ccc(-c2nc3c(nc2C2=CCC(F)C=C2)C=C(C2=CC=C(C4=Cc5nc(-c6ccc(F)cc6)c(-c6ccc(F)cc6)nc5CC4)CC2)CC3)cc1 |
| InChI | InChI=1S/C46H34F4N4/c47-35-15-5-29(6-16-35)43-45(31-9-19-37(49)20-10-31)53-41-25-33(13-23-39(41)51-43)27-1-2-28(4-3-27)34-14-24-40-42(26-34)54-46(32-11-21-38(50)22-12-32)44(52-40)30-7-17-36(48)18-8-30/h1-2,5-12,15-21,25-26,38H,3-4,13-14,22-24H2 |
| InChIKey | JSQHKBKXXAIPSL-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.80 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |