About N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine
N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 89188135) has the molecular formula C9H10N4S2
and a molecular weight of 238.34 g/mol. Its IUPAC name is N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 89188135 |
| Molecular Formula | C9H10N4S2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(NSc2ccc(N)cc2)s1 |
| InChI | InChI=1S/C9H10N4S2/c1-6-11-12-9(14-6)13-15-8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
| InChIKey | JQQPKTVSLBLLEM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine (CID 89188135) is N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine is Cc1nnc(NSc2ccc(N)cc2)s1.
What is the InChIKey of N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine?
The InChIKey is JQQPKTVSLBLLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S2/c1-6-11-12-9(14-6)13-15-8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13).
What are the key properties of N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine?
N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine has a molecular weight of 238.34 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)sulfanyl-5-methyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 89188135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).