About (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one
(3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one (PubChem CID 89188206) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one |
| PubChem CID | 89188206 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one |
| SMILES | C=C(C)/C(O)=C/C(C)=O |
| InChI | InChI=1S/C7H10O2/c1-5(2)7(9)4-6(3)8/h4,9H,1H2,2-3H3/b7-4- |
| InChIKey | YBJRBTOUVLEOEZ-DAXSKMNVSA-N |
| XLogP | 1.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one?
The IUPAC name of (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one (CID 89188206) is (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one.
What is the SMILES notation for (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one?
The canonical SMILES for (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one is C=C(C)/C(O)=C/C(C)=O.
What is the InChIKey of (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one?
The InChIKey is YBJRBTOUVLEOEZ-DAXSKMNVSA-N. The full InChI is InChI=1S/C7H10O2/c1-5(2)7(9)4-6(3)8/h4,9H,1H2,2-3H3/b7-4-.
What are the key properties of (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one?
(3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one has a molecular weight of 126.15 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-hydroxy-5-methylhexa-3,5-dien-2-one is sourced from PubChem (CID 89188206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).