About 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine
2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine (PubChem CID 89188300) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine |
| PubChem CID | 89188300 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine |
| SMILES | C=C(C1=NC=CCC1)C1C=CC=CN1 |
| InChI | InChI=1S/C12H14N2/c1-10(11-6-2-4-8-13-11)12-7-3-5-9-14-12/h2,4-6,8-9,11,13H,1,3,7H2 |
| InChIKey | SMYPPOUVPWYVBI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine?
The IUPAC name of 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine (CID 89188300) is 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine.
What is the SMILES notation for 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine?
The canonical SMILES for 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine is C=C(C1=NC=CCC1)C1C=CC=CN1.
What is the InChIKey of 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine?
The InChIKey is SMYPPOUVPWYVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-10(11-6-2-4-8-13-11)12-7-3-5-9-14-12/h2,4-6,8-9,11,13H,1,3,7H2.
What are the key properties of 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine?
2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine has a molecular weight of 186.26 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,2-dihydropyridin-2-yl)ethenyl]-3,4-dihydropyridine is sourced from PubChem (CID 89188300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).