About 1-cyclohexa-1,3-dien-1-yl-3-methylurea
1-cyclohexa-1,3-dien-1-yl-3-methylurea (PubChem CID 89188305) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-3-methylurea.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-3-methylurea |
| PubChem CID | 89188305 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-3-methylurea |
| SMILES | CNC(=O)NC1=CC=CCC1 |
| InChI | InChI=1S/C8H12N2O/c1-9-8(11)10-7-5-3-2-4-6-7/h2-3,5H,4,6H2,1H3,(H2,9,10,11) |
| InChIKey | OGAOEQWTHIFVHY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexa-1,3-dien-1-yl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-3-methylurea?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-3-methylurea (CID 89188305) is 1-cyclohexa-1,3-dien-1-yl-3-methylurea.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-3-methylurea?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-3-methylurea is CNC(=O)NC1=CC=CCC1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-3-methylurea?
The InChIKey is OGAOEQWTHIFVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-9-8(11)10-7-5-3-2-4-6-7/h2-3,5H,4,6H2,1H3,(H2,9,10,11).
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-3-methylurea?
1-cyclohexa-1,3-dien-1-yl-3-methylurea has a molecular weight of 152.20 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-3-methylurea is sourced from PubChem (CID 89188305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).