C23H23N5O3S — CID 89188639
(5E)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione (PubChem CID 89188639) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is (5E)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89188639 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (5E)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-3-ethyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1C(=O)S/C(=C/c2ccc(Nc3cnc4[nH]cc(C(=O)C(C)(C)C)c4n3)cc2)C1=O |
| InChI | InChI=1S/C23H23N5O3S/c1-5-28-21(30)16(32-22(28)31)10-13-6-8-14(9-7-13)26-17-12-25-20-18(27-17)15(11-24-20)19(29)23(2,3)4/h6-12H,5H2,1-4H3,(H,24,25)(H,26,27)/b16-10+ |
| InChIKey | WWWYKSFVWVMVJA-MHWRWJLKSA-N |
| XLogP | 4.99 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|