C13H17F3N2O — CID 89188665
(3S,4R)-4-[2-methoxy-2-(3,4,5-trifluorophenyl)ethyl]pyrrolidin-3-amine (PubChem CID 89188665) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is (3S,4R)-4-[2-methoxy-2-(3,4,5-trifluorophenyl)ethyl]pyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-[2-methoxy-2-(3,4,5-trifluorophenyl)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 89188665 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3S,4R)-4-[2-methoxy-2-(3,4,5-trifluorophenyl)ethyl]pyrrolidin-3-amine |
| SMILES | COC(C[C@@H]1CNC[C@H]1N)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H17F3N2O/c1-19-12(4-8-5-18-6-11(8)17)7-2-9(14)13(16)10(15)3-7/h2-3,8,11-12,18H,4-6,17H2,1H3/t8-,11-,12?/m1/s1 |
| InChIKey | DNUSNMRIVAIWAL-LYFNNULSSA-N |
| XLogP | 1.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|