About 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride
1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride (PubChem CID 89188767) has the molecular formula C13H19Cl2F3N2O
and a molecular weight of 347.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride |
| PubChem CID | 89188767 |
| Molecular Formula | C13H19Cl2F3N2O |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride |
| SMILES | COCCN1CC(N)C(c2cc(F)c(F)c(F)c2)C1.Cl.Cl |
| InChI | InChI=1S/C13H17F3N2O.2ClH/c1-19-3-2-18-6-9(12(17)7-18)8-4-10(14)13(16)11(15)5-8;;/h4-5,9,12H,2-3,6-7,17H2,1H3;2*1H |
| InChIKey | PTYOOBMZMFYKKB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride?
The IUPAC name of 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride (CID 89188767) is 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride.
What is the SMILES notation for 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride?
The canonical SMILES for 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride is COCCN1CC(N)C(c2cc(F)c(F)c(F)c2)C1.Cl.Cl.
What is the InChIKey of 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride?
The InChIKey is PTYOOBMZMFYKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O.2ClH/c1-19-3-2-18-6-9(12(17)7-18)8-4-10(14)13(16)11(15)5-8;;/h4-5,9,12H,2-3,6-7,17H2,1H3;2*1H.
What are the key properties of 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride?
1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride has a molecular weight of 347.21 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine;dihydrochloride is sourced from PubChem (CID 89188767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).