C27H42N6O4S — CID 89188978
(3S,6S,7R)-6-[[(2S)-2-aminobutanoyl]amino]-7-[(ethylcarbamothioylamino)methyl]-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 89188978) has the molecular formula C27H42N6O4S and a molecular weight of 546.74 g/mol. Its IUPAC name is (3S,6S,7R)-6-[[(2S)-2-aminobutanoyl]amino]-7-[(ethylcarbamothioylamino)methyl]-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | (3S,6S,7R)-6-[[(2S)-2-aminobutanoyl]amino]-7-[(ethylcarbamothioylamino)methyl]-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 89188978 |
| Molecular Formula | C27H42N6O4S |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | (3S,6S,7R)-6-[[(2S)-2-aminobutanoyl]amino]-7-[(ethylcarbamothioylamino)methyl]-N-[2-(4-methoxyphenyl)ethyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | CCNC(=S)NC[C@H]1CCC2CC[C@@H](C(=O)NCCc3ccc(OC)cc3)N2C(=O)[C@H]1NC(=O)[C@@H](N)CC |
| InChI | InChI=1S/C27H42N6O4S/c1-4-21(28)24(34)32-23-18(16-31-27(38)29-5-2)8-9-19-10-13-22(33(19)26(23)36)25(35)30-15-14-17-6-11-20(37-3)12-7-17/h6-7,11-12,18-19,21-23H,4-5,8-10,13-16,28H2,1-3H3,(H,30,35)(H,32,34)(H2,29,31,38)/t18-,19?,21+,22+,23+/m1/s1 |
| InChIKey | JLHBJIUYYJNAOR-CNBMZVDSSA-N |
| XLogP | 0.83 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|