About alpha-Glutarate malathion
alpha-Glutarate malathion (PubChem CID 89189) has the molecular formula C13H25O6PS2
and a molecular weight of 372.40 g/mol. Its IUPAC name is diethyl 2-diethoxyphosphinothioylsulfanylpentanedioate.
Molecular Properties
| Compound Name | alpha-Glutarate malathion |
| PubChem CID | 89189 |
| Molecular Formula | C13H25O6PS2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | diethyl 2-diethoxyphosphinothioylsulfanylpentanedioate |
| SMILES | CCOC(=O)CCC(C(=O)OCC)SP(=S)(OCC)OCC |
| InChI | InChI=1S/C13H25O6PS2/c1-5-16-12(14)10-9-11(13(15)17-6-2)22-20(21,18-7-3)19-8-4/h11H,5-10H2,1-4H3 |
| InChIKey | AZCYCJZIXYBDLT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 128.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | 381 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alpha-Glutarate malathion with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alpha-Glutarate malathion?
The IUPAC name of alpha-Glutarate malathion (CID 89189) is diethyl 2-diethoxyphosphinothioylsulfanylpentanedioate.
What is the SMILES notation for alpha-Glutarate malathion?
The canonical SMILES for alpha-Glutarate malathion is CCOC(=O)CCC(C(=O)OCC)SP(=S)(OCC)OCC.
What is the InChIKey of alpha-Glutarate malathion?
The InChIKey is AZCYCJZIXYBDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O6PS2/c1-5-16-12(14)10-9-11(13(15)17-6-2)22-20(21,18-7-3)19-8-4/h11H,5-10H2,1-4H3.
What are the key properties of alpha-Glutarate malathion?
alpha-Glutarate malathion has a molecular weight of 372.40 g/mol, XLogP of 3.20, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for alpha-Glutarate malathion is sourced from PubChem (CID 89189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).