C13H20F8S — CID 89189088
9,10,10,10-tetrafluoro-7-(fluoromethyl)-9-methyl-5-(trifluoromethyl)decane-1-thiol (PubChem CID 89189088) has the molecular formula C13H20F8S and a molecular weight of 360.35 g/mol. Its IUPAC name is 9,10,10,10-tetrafluoro-7-(fluoromethyl)-9-methyl-5-(trifluoromethyl)decane-1-thiol.
| Compound Name | 9,10,10,10-tetrafluoro-7-(fluoromethyl)-9-methyl-5-(trifluoromethyl)decane-1-thiol |
|---|---|
| PubChem CID | 89189088 |
| Molecular Formula | C13H20F8S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 9,10,10,10-tetrafluoro-7-(fluoromethyl)-9-methyl-5-(trifluoromethyl)decane-1-thiol |
| SMILES | CC(F)(CC(CF)CC(CCCCS)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20F8S/c1-11(15,13(19,20)21)7-9(8-14)6-10(12(16,17)18)4-2-3-5-22/h9-10,22H,2-8H2,1H3 |
| InChIKey | HNQDTIPBFPOLBG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|