C11H16F8S — CID 89189121
7,8,8,8-tetrafluoro-5-(fluoromethyl)-7-methyl-3-(trifluoromethyl)octane-1-thiol (PubChem CID 89189121) has the molecular formula C11H16F8S and a molecular weight of 332.30 g/mol. Its IUPAC name is 7,8,8,8-tetrafluoro-5-(fluoromethyl)-7-methyl-3-(trifluoromethyl)octane-1-thiol.
| Compound Name | 7,8,8,8-tetrafluoro-5-(fluoromethyl)-7-methyl-3-(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 89189121 |
| Molecular Formula | C11H16F8S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 7,8,8,8-tetrafluoro-5-(fluoromethyl)-7-methyl-3-(trifluoromethyl)octane-1-thiol |
| SMILES | CC(F)(CC(CF)CC(CCS)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16F8S/c1-9(13,11(17,18)19)5-7(6-12)4-8(2-3-20)10(14,15)16/h7-8,20H,2-6H2,1H3 |
| InChIKey | OOGXGELQSZAABQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|