About 4H-chromene;methane;nickel
4H-chromene;methane;nickel (PubChem CID 89189143) has the molecular formula C10H12NiO
and a molecular weight of 206.90 g/mol. Its IUPAC name is 4H-chromene;methane;nickel.
Molecular Properties
| Compound Name | 4H-chromene;methane;nickel |
| PubChem CID | 89189143 |
| Molecular Formula | C10H12NiO |
| Molecular Weight | 206.90 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 4H-chromene;methane;nickel |
| SMILES | C.C1=COc2ccccc2C1.[Ni] |
| InChI | InChI=1S/C9H8O.CH4.Ni/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-4,6-7H,5H2;1H4; |
| InChIKey | NJBUCBGSWIELPZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.90 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4H-chromene;methane;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-chromene;methane;nickel?
The IUPAC name of 4H-chromene;methane;nickel (CID 89189143) is 4H-chromene;methane;nickel.
What is the SMILES notation for 4H-chromene;methane;nickel?
The canonical SMILES for 4H-chromene;methane;nickel is C.C1=COc2ccccc2C1.[Ni].
What is the InChIKey of 4H-chromene;methane;nickel?
The InChIKey is NJBUCBGSWIELPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.CH4.Ni/c1-2-6-9-8(4-1)5-3-7-10-9;;/h1-4,6-7H,5H2;1H4;.
What are the key properties of 4H-chromene;methane;nickel?
4H-chromene;methane;nickel has a molecular weight of 206.90 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-chromene;methane;nickel is sourced from PubChem (CID 89189143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).