C19H17Cl2F3N2O — CID 89189244
4-(2,5-dichloro-6-fluoro-3-phenylphenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine (PubChem CID 89189244) has the molecular formula C19H17Cl2F3N2O and a molecular weight of 417.26 g/mol. Its IUPAC name is 4-(2,5-dichloro-6-fluoro-3-phenylphenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine.
| Compound Name | 4-(2,5-dichloro-6-fluoro-3-phenylphenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 89189244 |
| Molecular Formula | C19H17Cl2F3N2O |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 4-(2,5-dichloro-6-fluoro-3-phenylphenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
| SMILES | CC1(C)OC(N)=NC(C)(c2c(F)c(Cl)cc(-c3ccccc3)c2Cl)C1(F)F |
| InChI | InChI=1S/C19H17Cl2F3N2O/c1-17(2)19(23,24)18(3,26-16(25)27-17)13-14(21)11(9-12(20)15(13)22)10-7-5-4-6-8-10/h4-9H,1-3H3,(H2,25,26) |
| InChIKey | ISSRQOBTIGKSDM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|