C25H31N3O6S2 — CID 89189273
3-[[3,4-dimethyl-6-[2,4,6-trimethyl-3-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 89189273) has the molecular formula C25H31N3O6S2 and a molecular weight of 533.67 g/mol. Its IUPAC name is 3-[[3,4-dimethyl-6-[2,4,6-trimethyl-3-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-[[3,4-dimethyl-6-[2,4,6-trimethyl-3-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89189273 |
| Molecular Formula | C25H31N3O6S2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 3-[[3,4-dimethyl-6-[2,4,6-trimethyl-3-(trioxidanylsulfanyl)anilino]-2-pyridinyl]amino]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(Nc2c(C)cc(C)c(SOOO)c2C)nc(Nc2c(C)cc(C)c(S(=O)(=O)O)c2C)c1C |
| InChI | InChI=1S/C25H31N3O6S2/c1-12-11-20(26-21-13(2)9-15(4)23(18(21)7)35-34-33-29)27-25(17(12)6)28-22-14(3)10-16(5)24(19(22)8)36(30,31)32/h9-11,29H,1-8H3,(H2,26,27,28)(H,30,31,32) |
| InChIKey | WDLUNARVGLNIHC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|