C18H27N3 — CID 89189652
(6E,9aR)-5-ethenyl-6-ethylidene-1-propyl-2,3,4,4a,7,9-hexahydropyrrolo[3,4-g]quinolin-9a-amine (PubChem CID 89189652) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (6E,9aR)-5-ethenyl-6-ethylidene-1-propyl-2,3,4,4a,7,9-hexahydropyrrolo[3,4-g]quinolin-9a-amine.
| Compound Name | (6E,9aR)-5-ethenyl-6-ethylidene-1-propyl-2,3,4,4a,7,9-hexahydropyrrolo[3,4-g]quinolin-9a-amine |
|---|---|
| PubChem CID | 89189652 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (6E,9aR)-5-ethenyl-6-ethylidene-1-propyl-2,3,4,4a,7,9-hexahydropyrrolo[3,4-g]quinolin-9a-amine |
| SMILES | C=CC1=c2c(c[nH]/c2=C/C)C[C@]2(N)C1CCCN2CCC |
| InChI | InChI=1S/C18H27N3/c1-4-9-21-10-7-8-15-14(5-2)17-13(11-18(15,21)19)12-20-16(17)6-3/h5-6,12,15,20H,2,4,7-11,19H2,1,3H3/b16-6+/t15?,18-/m1/s1 |
| InChIKey | FCMPTZZHXFCSES-XJJDICEQSA-N |
| XLogP | 1.48 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |