C23H24ClN3O4 — CID 89189680
N-[2-[[2-(2-amino-4-chlorophenoxy)anilino]methyl]-4,5-dimethoxyphenyl]acetamide (PubChem CID 89189680) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is N-[2-[[2-(2-amino-4-chlorophenoxy)anilino]methyl]-4,5-dimethoxyphenyl]acetamide.
| Compound Name | N-[2-[[2-(2-amino-4-chlorophenoxy)anilino]methyl]-4,5-dimethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 89189680 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-[2-[[2-(2-amino-4-chlorophenoxy)anilino]methyl]-4,5-dimethoxyphenyl]acetamide |
| SMILES | COc1cc(CNc2ccccc2Oc2ccc(Cl)cc2N)c(NC(C)=O)cc1OC |
| InChI | InChI=1S/C23H24ClN3O4/c1-14(28)27-19-12-23(30-3)22(29-2)10-15(19)13-26-18-6-4-5-7-21(18)31-20-9-8-16(24)11-17(20)25/h4-12,26H,13,25H2,1-3H3,(H,27,28) |
| InChIKey | SAYJPEWVAFBQRL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|