C21H18N4 — CID 89189689
N-[1-[6-(1H-benzimidazol-2-yl)-2-pyridinyl]ethenyl]-2-methylaniline (PubChem CID 89189689) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[1-[6-(1H-benzimidazol-2-yl)-2-pyridinyl]ethenyl]-2-methylaniline.
| Compound Name | N-[1-[6-(1H-benzimidazol-2-yl)-2-pyridinyl]ethenyl]-2-methylaniline |
|---|---|
| PubChem CID | 89189689 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[1-[6-(1H-benzimidazol-2-yl)-2-pyridinyl]ethenyl]-2-methylaniline |
| SMILES | C=C(Nc1ccccc1C)c1cccc(-c2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C21H18N4/c1-14-8-3-4-9-16(14)22-15(2)17-12-7-13-20(23-17)21-24-18-10-5-6-11-19(18)25-21/h3-13,22H,2H2,1H3,(H,24,25) |
| InChIKey | MYDPWKPZHUWDPJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |