C20H32O5 — CID 89189772
[2-(2,6-dimethyl-5-oxohept-6-en-2-yl)-5-ethyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate (PubChem CID 89189772) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [2-(2,6-dimethyl-5-oxohept-6-en-2-yl)-5-ethyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-(2,6-dimethyl-5-oxohept-6-en-2-yl)-5-ethyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89189772 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [2-(2,6-dimethyl-5-oxohept-6-en-2-yl)-5-ethyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CCC(C)(C)C1OCC(CC)(COC(=O)C(=C)C)CO1 |
| InChI | InChI=1S/C20H32O5/c1-8-20(11-23-17(22)15(4)5)12-24-18(25-13-20)19(6,7)10-9-16(21)14(2)3/h18H,2,4,8-13H2,1,3,5-7H3 |
| InChIKey | FJZYVSMRPSZJMA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|