C16H26N2O4 — CID 89189781
[2,2-dimethyl-3-(prop-2-enoylamino)propyl] 2,2-dimethyl-3-(prop-2-enoylamino)propanoate (PubChem CID 89189781) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is [2,2-dimethyl-3-(prop-2-enoylamino)propyl] 2,2-dimethyl-3-(prop-2-enoylamino)propanoate.
| Compound Name | [2,2-dimethyl-3-(prop-2-enoylamino)propyl] 2,2-dimethyl-3-(prop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 89189781 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [2,2-dimethyl-3-(prop-2-enoylamino)propyl] 2,2-dimethyl-3-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)NCC(C)(C)COC(=O)C(C)(C)CNC(=O)C=C |
| InChI | InChI=1S/C16H26N2O4/c1-7-12(19)17-9-15(3,4)11-22-14(21)16(5,6)10-18-13(20)8-2/h7-8H,1-2,9-11H2,3-6H3,(H,17,19)(H,18,20) |
| InChIKey | WGPDIMVZTBQHJM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|