C12H16F4N2O2 — CID 89189787
2-methyl-N-[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoylamino)butyl]prop-2-enamide (PubChem CID 89189787) has the molecular formula C12H16F4N2O2 and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-methyl-N-[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoylamino)butyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoylamino)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 89189787 |
| Molecular Formula | C12H16F4N2O2 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-methyl-N-[2,2,3,3-tetrafluoro-4-(2-methylprop-2-enoylamino)butyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(F)(F)C(F)(F)CNC(=O)C(=C)C |
| InChI | InChI=1S/C12H16F4N2O2/c1-7(2)9(19)17-5-11(13,14)12(15,16)6-18-10(20)8(3)4/h1,3,5-6H2,2,4H3,(H,17,19)(H,18,20) |
| InChIKey | QPNSBPRPSKZGRS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|