C13H16F4O3 — CID 89189800
(2,2,3,3-tetrafluoro-7-methyl-6-oxooct-7-enyl) 2-methylprop-2-enoate (PubChem CID 89189800) has the molecular formula C13H16F4O3 and a molecular weight of 296.26 g/mol. Its IUPAC name is (2,2,3,3-tetrafluoro-7-methyl-6-oxooct-7-enyl) 2-methylprop-2-enoate.
| Compound Name | (2,2,3,3-tetrafluoro-7-methyl-6-oxooct-7-enyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89189800 |
| Molecular Formula | C13H16F4O3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2,2,3,3-tetrafluoro-7-methyl-6-oxooct-7-enyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CCC(F)(F)C(F)(F)COC(=O)C(=C)C |
| InChI | InChI=1S/C13H16F4O3/c1-8(2)10(18)5-6-12(14,15)13(16,17)7-20-11(19)9(3)4/h1,3,5-7H2,2,4H3 |
| InChIKey | HOTFXCJAZLWOBW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|