C12H19NO — CID 89189804
(4aR,5R)-4-ethyl-5,6-dimethyl-2,3,4a,5-tetrahydro-1,4-benzoxazine (PubChem CID 89189804) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (4aR,5R)-4-ethyl-5,6-dimethyl-2,3,4a,5-tetrahydro-1,4-benzoxazine.
| Compound Name | (4aR,5R)-4-ethyl-5,6-dimethyl-2,3,4a,5-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 89189804 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (4aR,5R)-4-ethyl-5,6-dimethyl-2,3,4a,5-tetrahydro-1,4-benzoxazine |
| SMILES | CCN1CCOC2=CC=C(C)[C@@H](C)[C@H]21 |
| InChI | InChI=1S/C12H19NO/c1-4-13-7-8-14-11-6-5-9(2)10(3)12(11)13/h5-6,10,12H,4,7-8H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | BPVKETNBPMDZFK-ZYHUDNBSSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |