C33H28ClF3N2O4S2 — CID 89189972
[(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfinate (PubChem CID 89189972) has the molecular formula C33H28ClF3N2O4S2 and a molecular weight of 673.18 g/mol. Its IUPAC name is [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfinate.
| Compound Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfinate |
|---|---|
| PubChem CID | 89189972 |
| Molecular Formula | C33H28ClF3N2O4S2 |
| Molecular Weight | 673.18 g/mol |
| Exact Mass | 672.11 |
| IUPAC Name | [(E)-[4-(4-chlorophenyl)sulfanyl-1-[9-ethyl-6-[(2E,4Z)-2-methylhepta-2,4,6-trienoyl]carbazol-3-yl]-1-oxobutan-2-ylidene]amino] trifluoromethanesulfinate |
| SMILES | C=C/C=C\C=C(/C)C(=O)c1ccc2c(c1)c1cc(C(=O)/C(CCSc3ccc(Cl)cc3)=N/OS(=O)C(F)(F)F)ccc1n2CC |
| InChI | InChI=1S/C33H28ClF3N2O4S2/c1-4-6-7-8-21(3)31(40)22-9-15-29-26(19-22)27-20-23(10-16-30(27)39(29)5-2)32(41)28(38-43-45(42)33(35,36)37)17-18-44-25-13-11-24(34)12-14-25/h4,6-16,19-20H,1,5,17-18H2,2-3H3/b7-6-,21-8+,38-28+ |
| InChIKey | QPBCKJYDQRHAOH-WGDTZMBBSA-N |
| XLogP | 9.26 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.18 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|