About [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate
[(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate (PubChem CID 89190254) has the molecular formula C14H30O4SSi
and a molecular weight of 322.54 g/mol. Its IUPAC name is [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate.
Molecular Properties
| Compound Name | [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate |
| PubChem CID | 89190254 |
| Molecular Formula | C14H30O4SSi |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H]1CC[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H30O4SSi/c1-14(2,3)20(5,6)17-10-9-12-7-8-13(11-12)18-19(4,15)16/h12-13H,7-11H2,1-6H3/t12-,13+/m1/s1 |
| InChIKey | DXIDSPQSXSSSDI-OLZOCXBDSA-N |
| XLogP | 3.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate?
The IUPAC name of [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate (CID 89190254) is [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate.
What is the SMILES notation for [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate?
The canonical SMILES for [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate is CC(C)(C)[Si](C)(C)OCC[C@H]1CC[C@H](OS(C)(=O)=O)C1.
What is the InChIKey of [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate?
The InChIKey is DXIDSPQSXSSSDI-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H30O4SSi/c1-14(2,3)20(5,6)17-10-9-12-7-8-13(11-12)18-19(4,15)16/h12-13H,7-11H2,1-6H3/t12-,13+/m1/s1.
What are the key properties of [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate?
[(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate has a molecular weight of 322.54 g/mol, XLogP of 3.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3R)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]cyclopentyl] methanesulfonate is sourced from PubChem (CID 89190254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).