C13H23NO — CID 89190327
(3S,4R,5R,6E)-3-(dimethylamino)-4,5-dimethylnona-6,8-dien-2-one (PubChem CID 89190327) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3S,4R,5R,6E)-3-(dimethylamino)-4,5-dimethylnona-6,8-dien-2-one.
| Compound Name | (3S,4R,5R,6E)-3-(dimethylamino)-4,5-dimethylnona-6,8-dien-2-one |
|---|---|
| PubChem CID | 89190327 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3S,4R,5R,6E)-3-(dimethylamino)-4,5-dimethylnona-6,8-dien-2-one |
| SMILES | C=C/C=C/[C@@H](C)[C@@H](C)[C@@H](C(C)=O)N(C)C |
| InChI | InChI=1S/C13H23NO/c1-7-8-9-10(2)11(3)13(12(4)15)14(5)6/h7-11,13H,1H2,2-6H3/b9-8+/t10-,11-,13+/m1/s1 |
| InChIKey | AYYRAZQXYJFUHW-NCYXYSDJSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|